* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-CHLORO-1-METHYL-4,5-DIHYDRO-6H-[1,2,4]TRIAZOLO[4,3-A][1,4]BENZODIAZEPIN-6-ONE |
English Synonyms: | 8-CHLORO-1-METHYL-4,5-DIHYDRO-6H-[1,2,4]TRIAZOLO[4,3-A][1,4]BENZODIAZEPIN-6-ONE |
MDL Number.: | MFCD18432197 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1nnc2n1-c3ccc(cc3C(=O)NC2)Cl |
InChi: | InChI=1S/C11H9ClN4O/c1-6-14-15-10-5-13-11(17)8-4-7(12)2-3-9(8)16(6)10/h2-4H,5H2,1H3,(H,13,17) |
InChiKey: | InChIKey=LHUBAPWIYFPXRQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.