* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (3S,4S)-4-AMINO-3,4-DIHYDRO-2H-CHROMEN-3-OL |
CAS: | 58810-67-6 |
English Synonyms: | (3S,4S)-4-AMINOCHROMAN-3-OL ; 4(S)-AMINOCHROMAN-3(S)-OL ; (3S,4S)-4-AMINO-3,4-DIHYDRO-2H-CHROMEN-3-OL |
MDL Number.: | MFCD18434494 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)[C@@H]([C@@H](CO2)O)N |
InChi: | InChI=1S/C9H11NO2/c10-9-6-3-1-2-4-8(6)12-5-7(9)11/h1-4,7,9,11H,5,10H2/t7-,9+/m1/s1 |
InChiKey: | InChIKey=JVPRWKWUBCZNJO-APPZFPTMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.