* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINAZOLINE-2,4,5-TRIAMINE |
| English Synonyms: | QUINAZOLINE-2,4,5-TRIAMINE |
| MDL Number.: | MFCD18448076 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | c1cc(c2c(c1)nc(nc2N)N)N |
| InChi: | InChI=1S/C8H9N5/c9-4-2-1-3-5-6(4)7(10)13-8(11)12-5/h1-3H,9H2,(H4,10,11,12,13) |
| InChiKey: | InChIKey=REUNOXHTPWSRBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.