* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3,5,6,8-PENTAHYDROXY-1,4-NAPHTHOQUINONE |
| CAS: | 1143-11-9 |
| English Synonyms: | 2,3,5,6,8-PENTAHYDROXY-1,4-NAPHTHOQUINONE |
| MDL Number.: | MFCD18449055 |
| H bond acceptor: | 7 |
| H bond donor: | 5 |
| Smile: | c1c(c2c(c(c1O)O)C(=O)C(=C(C2=O)O)O)O |
| InChi: | InChI=1S/C10H6O7/c11-2-1-3(12)6(13)5-4(2)7(14)9(16)10(17)8(5)15/h1,11-13,16-17H |
| InChiKey: | InChIKey=HYVDWYISUNRFCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.