* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-METHYL-5-VINYLTETRAZOLE |
| CAS: | 15284-39-6 |
| English Synonyms: | 2-METHYL-5-VINYLTETRAZOLE ; 5-ETHENYL-2-METHYL-2H-1,2,3,4-TETRAZOLE |
| MDL Number.: | MFCD18449753 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | Cn1nc(nn1)C=C |
| InChi: | InChI=1S/C4H6N4/c1-3-4-5-7-8(2)6-4/h3H,1H2,2H3 |
| InChiKey: | InChIKey=BHRMHWAEINWAJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.