* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-ETHYL-1,3,2-BENZODIOXABOROLE |
| CAS: | 40218-48-2 |
| English Synonyms: | 2-ETHYL-1,3,2-BENZODIOXABOROLE ; 2-ETHYL-2H-1,3,2-BENZODIOXABOROLE |
| MDL Number.: | MFCD18451457 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | B1(Oc2ccccc2O1)CC |
| InChi: | InChI=1S/C8H9BO2/c1-2-9-10-7-5-3-4-6-8(7)11-9/h3-6H,2H2,1H3 |
| InChiKey: | InChIKey=OSZXWGFDQLYWRA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.