* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA004683 |
English Synonyms: | ZERENEX ZXA004683 |
MDL Number.: | MFCD18453406 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCN(CC)Cc1ccc(s1)CNC(C)C |
InChi: | InChI=1S/C13H24N2S/c1-5-15(6-2)10-13-8-7-12(16-13)9-14-11(3)4/h7-8,11,14H,5-6,9-10H2,1-4H3 |
InChiKey: | InChIKey=BLHGFHZOVAGWQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.