* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA005623 |
English Synonyms: | ZERENEX ZXA005623 |
MDL Number.: | MFCD18453702 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COc1cccc(c1)N2C(=O)CC(C2=O)Sc3ccc(cc3)N |
InChi: | InChI=1S/C17H16N2O3S/c1-22-13-4-2-3-12(9-13)19-16(20)10-15(17(19)21)23-14-7-5-11(18)6-8-14/h2-9,15H,10,18H2,1H3 |
InChiKey: | InChIKey=IZUDMWITRWMZOB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.