* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA005915 |
English Synonyms: | ZERENEX ZXA005915 |
MDL Number.: | MFCD18453932 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC(C(=O)O)SC1=N/C(=C\c2ccc(cc2O)O)/C(=O)N1c3ccccc3 |
InChi: | InChI=1S/C19H16N2O5S/c1-11(18(25)26)27-19-20-15(9-12-7-8-14(22)10-16(12)23)17(24)21(19)13-5-3-2-4-6-13/h2-11,22-23H,1H3,(H,25,26)/b15-9- |
InChiKey: | InChIKey=GWRICYLJATZEOY-DHDCSXOGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.