* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA005917 |
English Synonyms: | ZERENEX ZXA005917 |
MDL Number.: | MFCD18453934 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CC(C(=O)O)SC1=N/C(=C/c2ccc(c(c2)OC)O)/C(=O)N1c3ccccc3 |
InChi: | InChI=1S/C20H18N2O5S/c1-12(19(25)26)28-20-21-15(10-13-8-9-16(23)17(11-13)27-2)18(24)22(20)14-6-4-3-5-7-14/h3-12,23H,1-2H3,(H,25,26)/b15-10+ |
InChiKey: | InChIKey=AYNOKMSXHJSWOI-XNTDXEJSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.