* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA005918 |
English Synonyms: | ZERENEX ZXA005918 |
MDL Number.: | MFCD18453935 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)N2C(=O)/C(=C/c3ccc(cc3)O)/N=C2SCC(=O)O |
InChi: | InChI=1S/C18H14N2O4S/c21-14-8-6-12(7-9-14)10-15-17(24)20(13-4-2-1-3-5-13)18(19-15)25-11-16(22)23/h1-10,21H,11H2,(H,22,23)/b15-10- |
InChiKey: | InChIKey=PQMAFSRUCIUIPP-GDNBJRDFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.