* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA005922 |
English Synonyms: | ZERENEX ZXA005922 |
MDL Number.: | MFCD18453939 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COc1cccc(c1O)/C=C\2/C(=O)N(C(=N2)SCC(=O)O)c3ccccc3 |
InChi: | InChI=1S/C19H16N2O5S/c1-26-15-9-5-6-12(17(15)24)10-14-18(25)21(13-7-3-2-4-8-13)19(20-14)27-11-16(22)23/h2-10,24H,11H2,1H3,(H,22,23)/b14-10- |
InChiKey: | InChIKey=KWLSEXIAFZBRGP-UVTDQMKNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.