* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA005923 |
English Synonyms: | ZERENEX ZXA005923 |
MDL Number.: | MFCD18453940 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)N2C(=O)/C(=C/c3ccc(cc3O)O)/N=C2SCC(=O)O |
InChi: | InChI=1S/C18H14N2O5S/c21-13-7-6-11(15(22)9-13)8-14-17(25)20(12-4-2-1-3-5-12)18(19-14)26-10-16(23)24/h1-9,21-22H,10H2,(H,23,24)/b14-8- |
InChiKey: | InChIKey=FAUJBQVRCHCNGY-ZSOIEALJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.