* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA005924 |
English Synonyms: | ZERENEX ZXA005924 |
MDL Number.: | MFCD18453941 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCOc1cccc(c1O)/C=C\2/C(=O)N(C(=N2)SCC(=O)O)c3ccccc3 |
InChi: | InChI=1S/C20H18N2O5S/c1-2-27-16-10-6-7-13(18(16)25)11-15-19(26)22(14-8-4-3-5-9-14)20(21-15)28-12-17(23)24/h3-11,25H,2,12H2,1H3,(H,23,24)/b15-11- |
InChiKey: | InChIKey=WBXMJARGFLLTFY-PTNGSMBKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.