* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXA006295 |
| English Synonyms: | ZERENEX ZXA006295 |
| MDL Number.: | MFCD18454172 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1cc(cc(c1)C2NC(CS2)C(=O)O)CN3CCCC3 |
| InChi: | InChI=1S/C15H20N2O2S/c18-15(19)13-10-20-14(16-13)12-5-3-4-11(8-12)9-17-6-1-2-7-17/h3-5,8,13-14,16H,1-2,6-7,9-10H2,(H,18,19) |
| InChiKey: | InChIKey=GWVPAAISBZXZTM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.