* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA006299 |
English Synonyms: | ZERENEX ZXA006299 |
MDL Number.: | MFCD18454176 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc(ccc1CN2CCCCC2)C3NC(CS3)C(=O)O |
InChi: | InChI=1S/C16H22N2O2S/c19-16(20)14-11-21-15(17-14)13-6-4-12(5-7-13)10-18-8-2-1-3-9-18/h4-7,14-15,17H,1-3,8-11H2,(H,19,20) |
InChiKey: | InChIKey=MMCWPSFJJJHOJC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.