* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA006300 |
English Synonyms: | ZERENEX ZXA006300 |
MDL Number.: | MFCD18454177 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(c(c1)CN2CCOCC2)C3NC(CS3)C(=O)O |
InChi: | InChI=1S/C15H20N2O3S/c18-15(19)13-10-21-14(16-13)12-4-2-1-3-11(12)9-17-5-7-20-8-6-17/h1-4,13-14,16H,5-10H2,(H,18,19) |
InChiKey: | InChIKey=NSWROYYUPLFAQE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.