* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXA006303 |
| English Synonyms: | ZERENEX ZXA006303 |
| MDL Number.: | MFCD18454180 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CN(C)Cc1c2ccccc2[nH]c1C3NC(CS3)C(=O)O |
| InChi: | InChI=1S/C15H19N3O2S/c1-18(2)7-10-9-5-3-4-6-11(9)16-13(10)14-17-12(8-21-14)15(19)20/h3-6,12,14,16-17H,7-8H2,1-2H3,(H,19,20) |
| InChiKey: | InChIKey=CENZJPSPNITNEN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.