* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA006306 |
English Synonyms: | ZERENEX ZXA006306 |
MDL Number.: | MFCD18454183 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1cc2c(cc1C)n(c(n2)C3NC(CS3)C(=O)O)C |
InChi: | InChI=1S/C14H17N3O2S/c1-7-4-9-11(5-8(7)2)17(3)12(15-9)13-16-10(6-20-13)14(18)19/h4-5,10,13,16H,6H2,1-3H3,(H,18,19) |
InChiKey: | InChIKey=FUORTYSEYNCFFO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.