* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA006560 |
English Synonyms: | ZERENEX ZXA006560 |
MDL Number.: | MFCD18454422 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC1(C(NC(S1)c2ccc(o2)c3ccc(cc3)S(=O)(=O)N)C(=O)O)C |
InChi: | InChI=1S/C16H18N2O5S2/c1-16(2)13(15(19)20)18-14(24-16)12-8-7-11(23-12)9-3-5-10(6-4-9)25(17,21)22/h3-8,13-14,18H,1-2H3,(H,19,20)(H2,17,21,22) |
InChiKey: | InChIKey=XZKBZTWOIPYMNF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.