* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA006564 |
English Synonyms: | ZERENEX ZXA006564 |
MDL Number.: | MFCD18454426 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CC1(C(NC(S1)c2ccc(o2)c3ccc(c(c3)[N+](=O)[O-])OC)C(=O)O)C |
InChi: | InChI=1S/C17H18N2O6S/c1-17(2)14(16(20)21)18-15(26-17)13-7-6-11(25-13)9-4-5-12(24-3)10(8-9)19(22)23/h4-8,14-15,18H,1-3H3,(H,20,21) |
InChiKey: | InChIKey=GOORTZVYSJBJLW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.