* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA006567 |
English Synonyms: | ZERENEX ZXA006567 |
MDL Number.: | MFCD18454429 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC1(C(NC(S1)c2ccc(o2)c3ccccc3C(F)(F)F)C(=O)O)C |
InChi: | InChI=1S/C17H16F3NO3S/c1-16(2)13(15(22)23)21-14(25-16)12-8-7-11(24-12)9-5-3-4-6-10(9)17(18,19)20/h3-8,13-14,21H,1-2H3,(H,22,23) |
InChiKey: | InChIKey=WAYKLWCHUWDAFO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.