* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA006912 |
English Synonyms: | ZERENEX ZXA006912 |
MDL Number.: | MFCD18454679 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C1CC1c2c(c(nc(c2C#N)SCCC(=O)O)N)C#N |
InChi: | InChI=1S/C13H12N4O2S/c14-5-8-11(7-1-2-7)9(6-15)13(17-12(8)16)20-4-3-10(18)19/h7H,1-4H2,(H2,16,17)(H,18,19) |
InChiKey: | InChIKey=XEQZALKQUAMYHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.