* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA007227 |
English Synonyms: | ZERENEX ZXA007227 |
MDL Number.: | MFCD18454920 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | CCOC(=O)c1c(c(sc1NC(=O)c2ccncc2C(=O)O)C(=O)Nc3ccccc3)C |
InChi: | InChI=1S/C22H19N3O6S/c1-3-31-22(30)16-12(2)17(19(27)24-13-7-5-4-6-8-13)32-20(16)25-18(26)14-9-10-23-11-15(14)21(28)29/h4-11H,3H2,1-2H3,(H,24,27)(H,25,26)(H,28,29) |
InChiKey: | InChIKey=SQPKKADIXMYNDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.