* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA007228 |
English Synonyms: | ZERENEX ZXA007228 |
MDL Number.: | MFCD18454921 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | Cc1c(c(sc1C(=O)Nc2ccccc2)NC(=O)c3ccncc3C(=O)O)C#N |
InChi: | InChI=1S/C20H14N4O4S/c1-11-14(9-21)19(24-17(25)13-7-8-22-10-15(13)20(27)28)29-16(11)18(26)23-12-5-3-2-4-6-12/h2-8,10H,1H3,(H,23,26)(H,24,25)(H,27,28) |
InChiKey: | InChIKey=NMDZYNSUEIFOAZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.