* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA007236 |
English Synonyms: | ZERENEX ZXA007236 |
MDL Number.: | MFCD18454928 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1CCN(CC1)C(=O)c2ccncc2C(=O)O |
InChi: | InChI=1S/C15H18N2O5/c1-2-22-15(21)10-4-7-17(8-5-10)13(18)11-3-6-16-9-12(11)14(19)20/h3,6,9-10H,2,4-5,7-8H2,1H3,(H,19,20) |
InChiKey: | InChIKey=LOEMOIQKVMOFJE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.