* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA007239 |
English Synonyms: | ZERENEX ZXA007239 |
MDL Number.: | MFCD18454931 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CCOC(=O)N1CCN(CC1)C(=O)c2ccncc2C(=O)O |
InChi: | InChI=1S/C14H17N3O5/c1-2-22-14(21)17-7-5-16(6-8-17)12(18)10-3-4-15-9-11(10)13(19)20/h3-4,9H,2,5-8H2,1H3,(H,19,20) |
InChiKey: | InChIKey=FFAVVUIHCNZAPV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.