* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA007241 |
English Synonyms: | ZERENEX ZXA007241 |
MDL Number.: | MFCD18454933 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1cc(ccc1N2CCN(CC2)C(=O)c3ccncc3C(=O)O)F |
InChi: | InChI=1S/C17H16FN3O3/c18-12-1-3-13(4-2-12)20-7-9-21(10-8-20)16(22)14-5-6-19-11-15(14)17(23)24/h1-6,11H,7-10H2,(H,23,24) |
InChiKey: | InChIKey=YUSWHVZBNQYZHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.