* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA008381 |
English Synonyms: | ZERENEX ZXA008381 |
MDL Number.: | MFCD18455858 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(c(cc1Cl)Cl)c2cnc(s2)CNCC3CCCCC3 |
InChi: | InChI=1S/C17H20Cl2N2S/c18-13-6-7-14(15(19)8-13)16-10-21-17(22-16)11-20-9-12-4-2-1-3-5-12/h6-8,10,12,20H,1-5,9,11H2 |
InChiKey: | InChIKey=XNDNGSABLRQKMX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.