* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA009562 |
English Synonyms: | ZERENEX ZXA009562 |
MDL Number.: | MFCD18457039 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc([nH]c1)c2cnc(s2)CNCc3cccnc3 |
InChi: | InChI=1S/C14H14N4S/c1-3-11(7-15-5-1)8-16-10-14-18-9-13(19-14)12-4-2-6-17-12/h1-7,9,16-17H,8,10H2 |
InChiKey: | InChIKey=HDLIEVDZVPRFGB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.