* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA009563 |
English Synonyms: | ZERENEX ZXA009563 |
MDL Number.: | MFCD18457040 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc([nH]c1)c2cnc(s2)CNCCC3=CCCCC3 |
InChi: | InChI=1S/C16H21N3S/c1-2-5-13(6-3-1)8-10-17-12-16-19-11-15(20-16)14-7-4-9-18-14/h4-5,7,9,11,17-18H,1-3,6,8,10,12H2 |
InChiKey: | InChIKey=PBAHCGUBRSXANA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.