* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA009584 |
English Synonyms: | ZERENEX ZXA009584 |
MDL Number.: | MFCD18457061 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc([nH]c1)c2cnc(s2)CNCC3CC4CC3C=C4 |
InChi: | InChI=1S/C16H19N3S/c1-2-14(18-5-1)15-9-19-16(20-15)10-17-8-13-7-11-3-4-12(13)6-11/h1-5,9,11-13,17-18H,6-8,10H2 |
InChiKey: | InChIKey=UEVBQFNWTLHMKG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.