* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA009586 |
English Synonyms: | ZERENEX ZXA009586 |
MDL Number.: | MFCD18457063 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)CN2CCC(CC2)NCc3ncc(s3)c4ccc[nH]4 |
InChi: | InChI=1S/C20H24N4S/c1-2-5-16(6-3-1)15-24-11-8-17(9-12-24)22-14-20-23-13-19(25-20)18-7-4-10-21-18/h1-7,10,13,17,21-22H,8-9,11-12,14-15H2 |
InChiKey: | InChIKey=IWOKBRVYTPZZIM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.