* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA009649 |
English Synonyms: | ZERENEX ZXA009649 |
MDL Number.: | MFCD18457126 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(oc1c2cnc(s2)CNN3CCCCC3)Br |
InChi: | InChI=1S/C13H16BrN3OS/c14-12-5-4-10(18-12)11-8-15-13(19-11)9-16-17-6-2-1-3-7-17/h4-5,8,16H,1-3,6-7,9H2 |
InChiKey: | InChIKey=WYWCQHJNDAXGIF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.