* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXA009658 |
| English Synonyms: | ZERENEX ZXA009658 |
| MDL Number.: | MFCD18457135 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc(ccc1CNCc2ncc(s2)c3ccc(o3)Br)C(F)(F)F |
| InChi: | InChI=1S/C16H12BrF3N2OS/c17-14-6-5-12(23-14)13-8-22-15(24-13)9-21-7-10-1-3-11(4-2-10)16(18,19)20/h1-6,8,21H,7,9H2 |
| InChiKey: | InChIKey=XZYNVNGCSXCWBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.