* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA010007 |
English Synonyms: | ZERENEX ZXA010007 |
MDL Number.: | MFCD18457484 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCOc1ccc(cc1)c2cnc(s2)CO |
InChi: | InChI=1S/C12H13NO2S/c1-2-15-10-5-3-9(4-6-10)11-7-13-12(8-14)16-11/h3-7,14H,2,8H2,1H3 |
InChiKey: | InChIKey=DERIJPZVXHFGDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.