* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXA011536 |
English Synonyms: | ZERENEX ZXA011536 |
MDL Number.: | MFCD18458308 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)CN2CCC(CC2)NCc3[nH]c4ccc(cc4n3)Cl |
InChi: | InChI=1S/C20H23ClN4/c21-16-6-7-18-19(12-16)24-20(23-18)13-22-17-8-10-25(11-9-17)14-15-4-2-1-3-5-15/h1-7,12,17,22H,8-11,13-14H2,(H,23,24) |
InChiKey: | InChIKey=SFPQQIWMMJLKCS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.