* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXA011538 |
| English Synonyms: | ZERENEX ZXA011538 |
| MDL Number.: | MFCD18458310 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | c1cc(ccc1CCNCc2[nH]c3ccc(cc3n2)Cl)S(=O)(=O)N |
| InChi: | InChI=1S/C16H17ClN4O2S/c17-12-3-6-14-15(9-12)21-16(20-14)10-19-8-7-11-1-4-13(5-2-11)24(18,22)23/h1-6,9,19H,7-8,10H2,(H,20,21)(H2,18,22,23) |
| InChiKey: | InChIKey=GGCQSMGNULSSNG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.