* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXA012328 |
| English Synonyms: | ZERENEX ZXA012328 |
| MDL Number.: | MFCD18458894 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(cc1)c2nc(cs2)CNN |
| InChi: | InChI=1S/C11H13N3S/c1-8-2-4-9(5-3-8)11-14-10(6-13-12)7-15-11/h2-5,7,13H,6,12H2,1H3 |
| InChiKey: | InChIKey=KUQAXYPOUBLAEA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.