* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW000950 |
| English Synonyms: | ZERENEX ZXW000950 |
| MDL Number.: | MFCD18459680 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)CCCCC2(C(=O)N)NC3CCCC3 |
| InChi: | InChI=1S/C17H24N2O/c18-16(20)17(19-14-9-2-3-10-14)12-6-5-8-13-7-1-4-11-15(13)17/h1,4,7,11,14,19H,2-3,5-6,8-10,12H2,(H2,18,20) |
| InChiKey: | InChIKey=BESBKOHKODCHTC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.