* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW000994 |
| English Synonyms: | ZERENEX ZXW000994 |
| MDL Number.: | MFCD18459688 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC1(CCC(c2c1cccc2)(C(=O)N)NC3CCCC3)C |
| InChi: | InChI=1S/C18H26N2O/c1-17(2)11-12-18(16(19)21,20-13-7-3-4-8-13)15-10-6-5-9-14(15)17/h5-6,9-10,13,20H,3-4,7-8,11-12H2,1-2H3,(H2,19,21) |
| InChiKey: | InChIKey=OGZHDDOZOXGWKW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.