* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW002340 |
| English Synonyms: | ZERENEX ZXW002340 |
| MDL Number.: | MFCD18460167 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC1(CCC(c2c1cccc2)(C(=O)N)NCC(F)(F)F)C |
| InChi: | InChI=1S/C15H19F3N2O/c1-13(2)7-8-14(12(19)21,20-9-15(16,17)18)11-6-4-3-5-10(11)13/h3-6,20H,7-9H2,1-2H3,(H2,19,21) |
| InChiKey: | InChIKey=WAVWXIPKKPDJFS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.