* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW004032 |
| English Synonyms: | ZERENEX ZXW004032 |
| MDL Number.: | MFCD18460901 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CC(C)[C@@H](C(=O)OC)NC(=O)c1ccc(c(c1)[N+](=O)[O-])Cl |
| InChi: | InChI=1S/C13H15ClN2O5/c1-7(2)11(13(18)21-3)15-12(17)8-4-5-9(14)10(6-8)16(19)20/h4-7,11H,1-3H3,(H,15,17)/t11-/m0/s1 |
| InChiKey: | InChIKey=LGLWLASEXNRJHO-NSHDSACASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.