* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW005566 |
| English Synonyms: | ZERENEX ZXW005566 |
| MDL Number.: | MFCD18461405 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1cc(c(cc1C(=O)Nc2c(ccs2)C(=O)N)[N+](=O)[O-])Cl |
| InChi: | InChI=1S/C12H8ClN3O4S/c13-8-2-1-6(5-9(8)16(19)20)11(18)15-12-7(10(14)17)3-4-21-12/h1-5H,(H2,14,17)(H,15,18) |
| InChiKey: | InChIKey=VPCUROOFTHPQDK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.