* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW010088 |
| English Synonyms: | ZERENEX ZXW010088 |
| MDL Number.: | MFCD18462935 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1cc(nc(c1C(=O)O)Nc2cc(ccc2F)F)C |
| InChi: | InChI=1S/C14H12F2N2O2/c1-7-5-8(2)17-13(12(7)14(19)20)18-11-6-9(15)3-4-10(11)16/h3-6H,1-2H3,(H,17,18)(H,19,20) |
| InChiKey: | InChIKey=PTVBYIBPHDKYSG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.