* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW019809 |
| English Synonyms: | ZERENEX ZXW019809 |
| MDL Number.: | MFCD18466668 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1cc(cc(c1)NC(=O)Nc2cc(ccc2Cl)Cl)CO |
| InChi: | InChI=1S/C14H12Cl2N2O2/c15-10-4-5-12(16)13(7-10)18-14(20)17-11-3-1-2-9(6-11)8-19/h1-7,19H,8H2,(H2,17,18,20) |
| InChiKey: | InChIKey=DNFUYUQHNUNWIJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.