* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW019812 |
| English Synonyms: | ZERENEX ZXW019812 |
| MDL Number.: | MFCD18466671 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccnc(c1)CCS(=O)(=O)Nc2cccc(c2)CO |
| InChi: | InChI=1S/C14H16N2O3S/c17-11-12-4-3-6-14(10-12)16-20(18,19)9-7-13-5-1-2-8-15-13/h1-6,8,10,16-17H,7,9,11H2 |
| InChiKey: | InChIKey=ROIBSEIBYCUXHC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.