* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW027886 |
| English Synonyms: | ZERENEX ZXW027886 |
| MDL Number.: | MFCD18469649 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCN(CC(=O)O)C(=O)/C=C/c1ccc(cc1)C(=O)N |
| InChi: | InChI=1S/C14H16N2O4/c1-2-16(9-13(18)19)12(17)8-5-10-3-6-11(7-4-10)14(15)20/h3-8H,2,9H2,1H3,(H2,15,20)(H,18,19)/b8-5+ |
| InChiKey: | InChIKey=BGIUDVRBFDQCTG-VMPITWQZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.