* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW030223 |
English Synonyms: | ZERENEX ZXW030223 |
MDL Number.: | MFCD18470424 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1cc(ccc1C(=O)NCC(=O)NCc2ccc(s2)Br)N |
InChi: | InChI=1S/C14H14BrN3O2S/c15-12-6-5-11(21-12)7-17-13(19)8-18-14(20)9-1-3-10(16)4-2-9/h1-6H,7-8,16H2,(H,17,19)(H,18,20) |
InChiKey: | InChIKey=ISUGWXDIRSDZKU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.