* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZXW032514 |
English Synonyms: | ZERENEX ZXW032514 |
MDL Number.: | MFCD18471622 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CCCN(CC(=O)Nc1ccc(cc1)C(=O)N)CC(=O)O |
InChi: | InChI=1S/C14H19N3O4/c1-2-7-17(9-13(19)20)8-12(18)16-11-5-3-10(4-6-11)14(15)21/h3-6H,2,7-9H2,1H3,(H2,15,21)(H,16,18)(H,19,20) |
InChiKey: | InChIKey=KGXHDGBONVTFQO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.